C14H8Br3Cl3N2O — CID 174975798
chloroform;2-naphthalen-1-yl-5-(tribromomethyl)-1,3,4-oxadiazole (PubChem CID 174975798) has the molecular formula C14H8Br3Cl3N2O and a molecular weight of 566.30 g/mol. Its IUPAC name is chloroform;2-naphthalen-1-yl-5-(tribromomethyl)-1,3,4-oxadiazole.
| Compound Name | chloroform;2-naphthalen-1-yl-5-(tribromomethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 174975798 |
| Molecular Formula | C14H8Br3Cl3N2O |
| Molecular Weight | 566.30 g/mol |
| Exact Mass | 561.73 |
| IUPAC Name | chloroform;2-naphthalen-1-yl-5-(tribromomethyl)-1,3,4-oxadiazole |
| SMILES | BrC(Br)(Br)c1nnc(-c2cccc3ccccc23)o1.ClC(Cl)Cl |
| InChI | InChI=1S/C13H7Br3N2O.CHCl3/c14-13(15,16)12-18-17-11(19-12)10-7-3-5-8-4-1-2-6-9(8)10;2-1(3)4/h1-7H;1H |
| InChIKey | DJBQYNCIQKCVDC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.30 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|