C22H18N6OS — CID 2816071
11,13-dimethyl-5-[(3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 2816071) has the molecular formula C22H18N6OS and a molecular weight of 414.49 g/mol. Its IUPAC name is 11,13-dimethyl-5-[(3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11,13-dimethyl-5-[(3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 2816071 |
| Molecular Formula | C22H18N6OS |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 11,13-dimethyl-5-[(3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(N=Cc3cn(-c4ccccc4)nc3C)cnc12 |
| InChI | InChI=1S/C22H18N6OS/c1-13-9-14(2)25-21-18(13)19-20(30-21)22(29)28(12-23-19)24-10-16-11-27(26-15(16)3)17-7-5-4-6-8-17/h4-12H,1-3H3 |
| InChIKey | FEMPIMNWMZEANR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|