C20H15ClN4O3S — CID 2816223
ethyl (5E)-4-(4-chlorophenyl)-5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-1,3,4-thiadiazole-2-carboxylate (PubChem CID 2816223) has the molecular formula C20H15ClN4O3S and a molecular weight of 426.89 g/mol. Its IUPAC name is ethyl (5E)-4-(4-chlorophenyl)-5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl (5E)-4-(4-chlorophenyl)-5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 2816223 |
| Molecular Formula | C20H15ClN4O3S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | ethyl (5E)-4-(4-chlorophenyl)-5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2)/C(=C2\C(=O)NN=C2c2ccccc2)S1 |
| InChI | InChI=1S/C20H15ClN4O3S/c1-2-28-20(27)18-24-25(14-10-8-13(21)9-11-14)19(29-18)15-16(22-23-17(15)26)12-6-4-3-5-7-12/h3-11H,2H2,1H3,(H,23,26)/b19-15+ |
| InChIKey | SYSGVBLEOXYQNU-XDJHFCHBSA-N |
| XLogP | 3.52 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|