C26H25N3O4 — CID 2817064
ethyl 2-(N-[2-[(3-cyano-4-methyl-6-phenyl-2-pyridinyl)oxy]acetyl]-2-methylanilino)acetate (PubChem CID 2817064) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl 2-(N-[2-[(3-cyano-4-methyl-6-phenyl-2-pyridinyl)oxy]acetyl]-2-methylanilino)acetate.
| Compound Name | ethyl 2-(N-[2-[(3-cyano-4-methyl-6-phenyl-2-pyridinyl)oxy]acetyl]-2-methylanilino)acetate |
|---|---|
| PubChem CID | 2817064 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | ethyl 2-(N-[2-[(3-cyano-4-methyl-6-phenyl-2-pyridinyl)oxy]acetyl]-2-methylanilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)COc1nc(-c2ccccc2)cc(C)c1C#N)c1ccccc1C |
| InChI | InChI=1S/C26H25N3O4/c1-4-32-25(31)16-29(23-13-9-8-10-18(23)2)24(30)17-33-26-21(15-27)19(3)14-22(28-26)20-11-6-5-7-12-20/h5-14H,4,16-17H2,1-3H3 |
| InChIKey | PFVYUZAWOKNYCY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |