C7H10BrN3S — CID 2820281
2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanethioamide (PubChem CID 2820281) has the molecular formula C7H10BrN3S and a molecular weight of 248.15 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanethioamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanethioamide |
|---|---|
| PubChem CID | 2820281 |
| Molecular Formula | C7H10BrN3S |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanethioamide |
| SMILES | Cc1nn(CC(N)=S)c(C)c1Br |
| InChI | InChI=1S/C7H10BrN3S/c1-4-7(8)5(2)11(10-4)3-6(9)12/h3H2,1-2H3,(H2,9,12) |
| InChIKey | GCUCQQALIUJZMT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|