C13H10ClN3O3S2 — CID 2820508
3-[(4-chlorophenyl)hydrazinylidene]-1-methyl-2,2-dioxothieno[3,2-c]thiazin-4-one (PubChem CID 2820508) has the molecular formula C13H10ClN3O3S2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)hydrazinylidene]-1-methyl-2,2-dioxothieno[3,2-c]thiazin-4-one.
| Compound Name | 3-[(4-chlorophenyl)hydrazinylidene]-1-methyl-2,2-dioxothieno[3,2-c]thiazin-4-one |
|---|---|
| PubChem CID | 2820508 |
| Molecular Formula | C13H10ClN3O3S2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-[(4-chlorophenyl)hydrazinylidene]-1-methyl-2,2-dioxothieno[3,2-c]thiazin-4-one |
| SMILES | CN1c2ccsc2C(=O)C(=NNc2ccc(Cl)cc2)S1(=O)=O |
| InChI | InChI=1S/C13H10ClN3O3S2/c1-17-10-6-7-21-12(10)11(18)13(22(17,19)20)16-15-9-4-2-8(14)3-5-9/h2-7,15H,1H3 |
| InChIKey | OZMVDOREBOZLHR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|