C12H11N5S — CID 2820651
6-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1H-pyrimidine-2-thione (PubChem CID 2820651) has the molecular formula C12H11N5S and a molecular weight of 257.32 g/mol. Its IUPAC name is 6-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1H-pyrimidine-2-thione.
| Compound Name | 6-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 2820651 |
| Molecular Formula | C12H11N5S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 6-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1H-pyrimidine-2-thione |
| SMILES | Cc1cc2ncc(-c3ccnc(=S)[nH]3)c(C)n2n1 |
| InChI | InChI=1S/C12H11N5S/c1-7-5-11-14-6-9(8(2)17(11)16-7)10-3-4-13-12(18)15-10/h3-6H,1-2H3,(H,13,15,18) |
| InChIKey | RPLVZPYABAXZBZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|