C12H17N3 — CID 59253392
6-tert-butyl-2,7-dimethylpyrazolo[1,5-a]pyrimidine (PubChem CID 59253392) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-tert-butyl-2,7-dimethylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 6-tert-butyl-2,7-dimethylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 59253392 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 6-tert-butyl-2,7-dimethylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc2ncc(C(C)(C)C)c(C)n2n1 |
| InChI | InChI=1S/C12H17N3/c1-8-6-11-13-7-10(12(3,4)5)9(2)15(11)14-8/h6-7H,1-5H3 |
| InChIKey | BXZCJUPUSYCQBA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |