C17H12ClF3N4OS — CID 2821080
4-chloro-N-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]benzamide (PubChem CID 2821080) has the molecular formula C17H12ClF3N4OS and a molecular weight of 412.82 g/mol. Its IUPAC name is 4-chloro-N-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2821080 |
| Molecular Formula | C17H12ClF3N4OS |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-chloro-N-[[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]benzamide |
| SMILES | Cn1nc(-c2ccc(C=NNC(=O)c3ccc(Cl)cc3)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H12ClF3N4OS/c1-25-15(17(19,20)21)8-13(24-25)14-7-6-12(27-14)9-22-23-16(26)10-2-4-11(18)5-3-10/h2-9H,1H3,(H,23,26) |
| InChIKey | YRCMSQOIKAEGSH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|