C19H16Cl2N4OS — CID 2821345
N-[(2-chlorophenyl)methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]-3-methylimidazole-4-carboxamide (PubChem CID 2821345) has the molecular formula C19H16Cl2N4OS and a molecular weight of 419.34 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 2821345 |
| Molecular Formula | C19H16Cl2N4OS |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1c(C(=O)NN=Cc2ccccc2Cl)cnc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N4OS/c1-25-17(18(26)24-23-10-14-4-2-3-5-16(14)21)11-22-19(25)27-12-13-6-8-15(20)9-7-13/h2-11H,12H2,1H3,(H,24,26) |
| InChIKey | IRSBTZBZAVKOSK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|