C18H12Cl3N5O3 — CID 39937337
1-[(4-chlorophenyl)methyl]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-nitropyrazole-5-carboxamide (PubChem CID 39937337) has the molecular formula C18H12Cl3N5O3 and a molecular weight of 452.69 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-nitropyrazole-5-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 39937337 |
| Molecular Formula | C18H12Cl3N5O3 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-nitropyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(Cl)c1Cl)c1cc([N+](=O)[O-])nn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl3N5O3/c19-13-6-4-11(5-7-13)10-25-15(8-16(24-25)26(28)29)18(27)23-22-9-12-2-1-3-14(20)17(12)21/h1-9H,10H2,(H,23,27)/b22-9+ |
| InChIKey | BOZUSZYOPLIBLP-LSFURLLWSA-N |
| XLogP | 4.56 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|