C12H10F3N3O2S — CID 2821357
5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide (PubChem CID 2821357) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide.
| Compound Name | 5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 2821357 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide |
| SMILES | NNC(=O)c1ccc(CSc2ccc(C(F)(F)F)cn2)o1 |
| InChI | InChI=1S/C12H10F3N3O2S/c13-12(14,15)7-1-4-10(17-5-7)21-6-8-2-3-9(20-8)11(19)18-16/h1-5H,6,16H2,(H,18,19) |
| InChIKey | VUDZPUWSTPDFTA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|