C23H22F3N3O3S — CID 2821435
N'-(4-tert-butylbenzoyl)-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide (PubChem CID 2821435) has the molecular formula C23H22F3N3O3S and a molecular weight of 477.51 g/mol. Its IUPAC name is N'-(4-tert-butylbenzoyl)-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide.
| Compound Name | N'-(4-tert-butylbenzoyl)-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 2821435 |
| Molecular Formula | C23H22F3N3O3S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N'-(4-tert-butylbenzoyl)-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-2-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)c2ccc(CSc3ccc(C(F)(F)F)cn3)o2)cc1 |
| InChI | InChI=1S/C23H22F3N3O3S/c1-22(2,3)15-6-4-14(5-7-15)20(30)28-29-21(31)18-10-9-17(32-18)13-33-19-11-8-16(12-27-19)23(24,25)26/h4-12H,13H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | NQXFBHXIXARJKK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|