C21H29ClN4S — CID 2824033
6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-3-(pyridin-3-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydrochloride (PubChem CID 2824033) has the molecular formula C21H29ClN4S and a molecular weight of 405.01 g/mol. Its IUPAC name is 6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-3-(pyridin-3-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydrochloride.
| Compound Name | 6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-3-(pyridin-3-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydrochloride |
|---|---|
| PubChem CID | 2824033 |
| Molecular Formula | C21H29ClN4S |
| Molecular Weight | 405.01 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]-3-(pyridin-3-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydrochloride |
| SMILES | Cc1c(C)c(C)c(CSC2=NCN(Cc3cccnc3)CN2)c(C)c1C.Cl |
| InChI | InChI=1S/C21H28N4S.ClH/c1-14-15(2)17(4)20(18(5)16(14)3)11-26-21-23-12-25(13-24-21)10-19-7-6-8-22-9-19;/h6-9H,10-13H2,1-5H3,(H,23,24);1H |
| InChIKey | ZUORSPDDTSXOMG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.01 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |