C16H6Cl4O2S2 — CID 2824407
3,4-bis[(2,6-dichlorophenyl)sulfanyl]cyclobut-3-ene-1,2-dione (PubChem CID 2824407) has the molecular formula C16H6Cl4O2S2 and a molecular weight of 436.17 g/mol. Its IUPAC name is 3,4-bis[(2,6-dichlorophenyl)sulfanyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis[(2,6-dichlorophenyl)sulfanyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 2824407 |
| Molecular Formula | C16H6Cl4O2S2 |
| Molecular Weight | 436.17 g/mol |
| Exact Mass | 433.86 |
| IUPAC Name | 3,4-bis[(2,6-dichlorophenyl)sulfanyl]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Sc2c(Cl)cccc2Cl)c(Sc2c(Cl)cccc2Cl)c1=O |
| InChI | InChI=1S/C16H6Cl4O2S2/c17-7-3-1-4-8(18)13(7)23-15-11(21)12(22)16(15)24-14-9(19)5-2-6-10(14)20/h1-6H |
| InChIKey | YIQYCDDQSANLOS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.17 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|