C17H13F3N4O2S — CID 2824424
N-[4-(2-aminopyrimidin-4-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 2824424) has the molecular formula C17H13F3N4O2S and a molecular weight of 394.38 g/mol. Its IUPAC name is N-[4-(2-aminopyrimidin-4-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(2-aminopyrimidin-4-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2824424 |
| Molecular Formula | C17H13F3N4O2S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-[4-(2-aminopyrimidin-4-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Nc1nccc(-c2ccc(NS(=O)(=O)c3cccc(C(F)(F)F)c3)cc2)n1 |
| InChI | InChI=1S/C17H13F3N4O2S/c18-17(19,20)12-2-1-3-14(10-12)27(25,26)24-13-6-4-11(5-7-13)15-8-9-22-16(21)23-15/h1-10,24H,(H2,21,22,23) |
| InChIKey | PUYMMCSOTSHPBL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |