C27H26ClN3O4 — CID 2825987
(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl N-(3-chlorophenyl)carbamate (PubChem CID 2825987) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is (4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl N-(3-chlorophenyl)carbamate.
| Compound Name | (4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 2825987 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methyl N-(3-chlorophenyl)carbamate |
| SMILES | CCCCC1(COC(=O)Nc2cccc(Cl)c2)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H26ClN3O4/c1-2-3-17-27(19-35-26(34)29-21-12-10-11-20(28)18-21)24(32)30(22-13-6-4-7-14-22)31(25(27)33)23-15-8-5-9-16-23/h4-16,18H,2-3,17,19H2,1H3,(H,29,34) |
| InChIKey | BMQHMSKSNNLAHE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|