C16H8Cl2INO2 — CID 2826184
4-[(3,4-dichlorophenyl)methylidene]-2-(2-iodophenyl)-1,3-oxazol-5-one (PubChem CID 2826184) has the molecular formula C16H8Cl2INO2 and a molecular weight of 444.06 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylidene]-2-(2-iodophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(3,4-dichlorophenyl)methylidene]-2-(2-iodophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2826184 |
| Molecular Formula | C16H8Cl2INO2 |
| Molecular Weight | 444.06 g/mol |
| Exact Mass | 442.90 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylidene]-2-(2-iodophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2I)=NC1=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl2INO2/c17-11-6-5-9(7-12(11)18)8-14-16(21)22-15(20-14)10-3-1-2-4-13(10)19/h1-8H |
| InChIKey | CDNRHXJRWOXVNP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.06 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|