C11H15IN2O3S — CID 2826249
1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(4-iodophenyl)thiourea (PubChem CID 2826249) has the molecular formula C11H15IN2O3S and a molecular weight of 382.22 g/mol. Its IUPAC name is 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(4-iodophenyl)thiourea.
| Compound Name | 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(4-iodophenyl)thiourea |
|---|---|
| PubChem CID | 2826249 |
| Molecular Formula | C11H15IN2O3S |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(4-iodophenyl)thiourea |
| SMILES | OCC(CO)(CO)NC(=S)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C11H15IN2O3S/c12-8-1-3-9(4-2-8)13-10(18)14-11(5-15,6-16)7-17/h1-4,15-17H,5-7H2,(H2,13,14,18) |
| InChIKey | AZQVWHJZKSKPAM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|