C11H16N2O2S — CID 5081972
1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-phenylthiourea (PubChem CID 5081972) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-phenylthiourea.
| Compound Name | 1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 5081972 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-phenylthiourea |
| SMILES | CC(CO)(CO)NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C11H16N2O2S/c1-11(7-14,8-15)13-10(16)12-9-5-3-2-4-6-9/h2-6,14-15H,7-8H2,1H3,(H2,12,13,16) |
| InChIKey | MBPTUJWTWTZLRI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|