C20H22N2S — CID 722049
1-phenyl-3-(4-phenylhepta-1,6-dien-4-yl)thiourea (PubChem CID 722049) has the molecular formula C20H22N2S and a molecular weight of 322.48 g/mol. Its IUPAC name is 1-phenyl-3-(4-phenylhepta-1,6-dien-4-yl)thiourea.
| Compound Name | 1-phenyl-3-(4-phenylhepta-1,6-dien-4-yl)thiourea |
|---|---|
| PubChem CID | 722049 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-phenyl-3-(4-phenylhepta-1,6-dien-4-yl)thiourea |
| SMILES | C=CCC(CC=C)(NC(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2S/c1-3-15-20(16-4-2,17-11-7-5-8-12-17)22-19(23)21-18-13-9-6-10-14-18/h3-14H,1-2,15-16H2,(H2,21,22,23) |
| InChIKey | OEVWBFKEWJMHPJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|