C20H20F3N — CID 53495436
N-[4-[4-(trifluoromethyl)phenyl]hepta-1,6-dien-4-yl]aniline (PubChem CID 53495436) has the molecular formula C20H20F3N and a molecular weight of 331.38 g/mol. Its IUPAC name is N-[4-[4-(trifluoromethyl)phenyl]hepta-1,6-dien-4-yl]aniline.
| Compound Name | N-[4-[4-(trifluoromethyl)phenyl]hepta-1,6-dien-4-yl]aniline |
|---|---|
| PubChem CID | 53495436 |
| Molecular Formula | C20H20F3N |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[4-[4-(trifluoromethyl)phenyl]hepta-1,6-dien-4-yl]aniline |
| SMILES | C=CCC(CC=C)(Nc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3N/c1-3-14-19(15-4-2,24-18-8-6-5-7-9-18)16-10-12-17(13-11-16)20(21,22)23/h3-13,24H,1-2,14-15H2 |
| InChIKey | SVAVINQVHUPKRH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|