C14H17IN2O2S — CID 2826695
ethyl 4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)amino]benzoate iodide (PubChem CID 2826695) has the molecular formula C14H17IN2O2S and a molecular weight of 404.27 g/mol. Its IUPAC name is ethyl 4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)amino]benzoate iodide.
| Compound Name | ethyl 4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)amino]benzoate iodide |
|---|---|
| PubChem CID | 2826695 |
| Molecular Formula | C14H17IN2O2S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | ethyl 4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)amino]benzoate iodide |
| SMILES | CCOC(=O)c1ccc(Nc2scc(C)[n+]2C)cc1.[I-] |
| InChI | InChI=1S/C14H16N2O2S.HI/c1-4-18-13(17)11-5-7-12(8-6-11)15-14-16(3)10(2)9-19-14;/h5-9H,4H2,1-3H3;1H |
| InChIKey | UEKHCJKCWABSTC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|