C13H11N3O8S — CID 2829047
ethyl 2-acetamido-7-hydroxy-4,6-dinitro-1-benzothiophene-3-carboxylate (PubChem CID 2829047) has the molecular formula C13H11N3O8S and a molecular weight of 369.31 g/mol. Its IUPAC name is ethyl 2-acetamido-7-hydroxy-4,6-dinitro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-acetamido-7-hydroxy-4,6-dinitro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2829047 |
| Molecular Formula | C13H11N3O8S |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | ethyl 2-acetamido-7-hydroxy-4,6-dinitro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)=O)sc2c(O)c([N+](=O)[O-])cc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C13H11N3O8S/c1-3-24-13(19)9-8-6(15(20)21)4-7(16(22)23)10(18)11(8)25-12(9)14-5(2)17/h4,18H,3H2,1-2H3,(H,14,17) |
| InChIKey | IIGUNLSMXWMKEU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|