C32H14N4O9 — CID 2832570
2-(1,3-dioxoisoindol-2-yl)-5-[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione (PubChem CID 2832570) has the molecular formula C32H14N4O9 and a molecular weight of 598.48 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-5-[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-5-[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 2832570 |
| Molecular Formula | C32H14N4O9 |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-5-[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1N1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)N(N3C(=O)c5ccccc5C3=O)C4=O)cc2C1=O |
| InChI | InChI=1S/C32H14N4O9/c37-25-17-5-1-2-6-18(17)26(38)33(25)35-29(41)21-11-9-15(13-23(21)31(35)43)45-16-10-12-22-24(14-16)32(44)36(30(22)42)34-27(39)19-7-3-4-8-20(19)28(34)40/h1-14H |
| InChIKey | NXFIYYSTCYHBFR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 158.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|