C16H8N2O5 — CID 3089909
5-(1,3-dioxoisoindol-5-yl)oxyisoindole-1,3-dione (PubChem CID 3089909) has the molecular formula C16H8N2O5 and a molecular weight of 308.25 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-5-yl)oxyisoindole-1,3-dione.
| Compound Name | 5-(1,3-dioxoisoindol-5-yl)oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 3089909 |
| Molecular Formula | C16H8N2O5 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 5-(1,3-dioxoisoindol-5-yl)oxyisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Oc3ccc4c(c3)C(=O)NC4=O)ccc21 |
| InChI | InChI=1S/C16H8N2O5/c19-13-9-3-1-7(5-11(9)15(21)17-13)23-8-2-4-10-12(6-8)16(22)18-14(10)20/h1-6H,(H,17,19,21)(H,18,20,22) |
| InChIKey | KYUQOJXNTSCEKL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|