C16H12N2O4 — CID 893435
N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]acetamide (PubChem CID 893435) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]acetamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]acetamide |
|---|---|
| PubChem CID | 893435 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-5-yl)oxyphenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Oc2ccc3c(c2)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C16H12N2O4/c1-9(19)17-10-3-2-4-11(7-10)22-12-5-6-13-14(8-12)16(21)18-15(13)20/h2-8H,1H3,(H,17,19)(H,18,20,21) |
| InChIKey | JCKPFNDDPSYQKL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|