C24H15Cl2N3O5 — CID 2835737
2-acetyl-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]imino-7-nitroinden-1-one (PubChem CID 2835737) has the molecular formula C24H15Cl2N3O5 and a molecular weight of 496.31 g/mol. Its IUPAC name is 2-acetyl-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]imino-7-nitroinden-1-one.
| Compound Name | 2-acetyl-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]imino-7-nitroinden-1-one |
|---|---|
| PubChem CID | 2835737 |
| Molecular Formula | C24H15Cl2N3O5 |
| Molecular Weight | 496.31 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 2-acetyl-3-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]imino-7-nitroinden-1-one |
| SMILES | CC(=O)C1C(=O)c2c(cccc2[N+](=O)[O-])/C1=N\c1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C24H15Cl2N3O5/c1-12(30)20-22(17-3-2-4-19(29(33)34)21(17)24(20)32)28-16-7-5-15(6-8-16)27-11-13-9-14(25)10-18(26)23(13)31/h2-11,20,31H,1H3/b27-11+,28-22+ |
| InChIKey | BSZCPDXOUFBMEN-PFNFCMEGSA-N |
| XLogP | 5.88 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.31 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|