C16H16N4O4 — CID 2836217
2-[4-(2-methyl-4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione (PubChem CID 2836217) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-[4-(2-methyl-4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(2-methyl-4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2836217 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[4-(2-methyl-4-nitroimidazol-1-yl)butyl]isoindole-1,3-dione |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16N4O4/c1-11-17-14(20(23)24)10-18(11)8-4-5-9-19-15(21)12-6-2-3-7-13(12)16(19)22/h2-3,6-7,10H,4-5,8-9H2,1H3 |
| InChIKey | KGAXPRHNOOXWRS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|