C18H25NO3 — CID 2836833
ethyl 2-cyclohexyl-3-(3-methylanilino)-3-oxopropanoate (PubChem CID 2836833) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is ethyl 2-cyclohexyl-3-(3-methylanilino)-3-oxopropanoate.
| Compound Name | ethyl 2-cyclohexyl-3-(3-methylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 2836833 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | ethyl 2-cyclohexyl-3-(3-methylanilino)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1cccc(C)c1)C1CCCCC1 |
| InChI | InChI=1S/C18H25NO3/c1-3-22-18(21)16(14-9-5-4-6-10-14)17(20)19-15-11-7-8-13(2)12-15/h7-8,11-12,14,16H,3-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | VJGOQIQXPLGGDD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|