C17H25FN2O — CID 2838041
N,N-diethyl-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 2838041) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is N,N-diethyl-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2838041 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N,N-diethyl-1-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H25FN2O/c1-3-20(4-2)17(21)15-8-6-10-19(13-15)12-14-7-5-9-16(18)11-14/h5,7,9,11,15H,3-4,6,8,10,12-13H2,1-2H3 |
| InChIKey | HLMFFJLTLCAFPU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |