C21H21BrN2OS — CID 2838908
4-(4-bromophenyl)-7,7-dimethyl-5-oxo-3-prop-2-enyl-2-sulfanylidene-1,4,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 2838908) has the molecular formula C21H21BrN2OS and a molecular weight of 429.38 g/mol. Its IUPAC name is 4-(4-bromophenyl)-7,7-dimethyl-5-oxo-3-prop-2-enyl-2-sulfanylidene-1,4,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 4-(4-bromophenyl)-7,7-dimethyl-5-oxo-3-prop-2-enyl-2-sulfanylidene-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 2838908 |
| Molecular Formula | C21H21BrN2OS |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-(4-bromophenyl)-7,7-dimethyl-5-oxo-3-prop-2-enyl-2-sulfanylidene-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | C=CCC1(C#N)C(=S)NC2=C(C(=O)CC(C)(C)C2)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H21BrN2OS/c1-4-9-21(12-23)18(13-5-7-14(22)8-6-13)17-15(24-19(21)26)10-20(2,3)11-16(17)25/h4-8,18H,1,9-11H2,2-3H3,(H,24,26) |
| InChIKey | GTMJEAVXRNJUAA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|