C19H20N2O2S — CID 3351631
ethyl 5-cyano-2-methyl-4-phenyl-5-prop-2-enyl-6-sulfanylidene-1,4-dihydropyridine-3-carboxylate (PubChem CID 3351631) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is ethyl 5-cyano-2-methyl-4-phenyl-5-prop-2-enyl-6-sulfanylidene-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 5-cyano-2-methyl-4-phenyl-5-prop-2-enyl-6-sulfanylidene-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 3351631 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | ethyl 5-cyano-2-methyl-4-phenyl-5-prop-2-enyl-6-sulfanylidene-1,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCC1(C#N)C(=S)NC(C)=C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-4-11-19(12-20)16(14-9-7-6-8-10-14)15(17(22)23-5-2)13(3)21-18(19)24/h4,6-10,16H,1,5,11H2,2-3H3,(H,21,24) |
| InChIKey | SBPOWAVDBDEKSZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|