C17H17FN2O3 — CID 2839169
ethyl 6-amino-5-cyano-2-ethyl-4-(4-fluorophenyl)-4H-pyran-3-carboxylate (PubChem CID 2839169) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-ethyl-4-(4-fluorophenyl)-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-ethyl-4-(4-fluorophenyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 2839169 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-ethyl-4-(4-fluorophenyl)-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CC)OC(N)=C(C#N)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O3/c1-3-13-15(17(21)22-4-2)14(12(9-19)16(20)23-13)10-5-7-11(18)8-6-10/h5-8,14H,3-4,20H2,1-2H3 |
| InChIKey | SHCOWGYBECTHKA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |