C24H21IN2O4 — CID 2840240
N-[1-(3,4-dimethoxyphenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2840240) has the molecular formula C24H21IN2O4 and a molecular weight of 528.35 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2840240 |
| Molecular Formula | C24H21IN2O4 |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)Nc2ccc(I)cc2)cc1OC |
| InChI | InChI=1S/C24H21IN2O4/c1-30-21-13-8-16(15-22(21)31-2)14-20(27-23(28)17-6-4-3-5-7-17)24(29)26-19-11-9-18(25)10-12-19/h3-15H,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | BHULQXNDENMMRJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|