C18H17N5 — CID 2842106
5,6-dimethyl-2-phenyl-N-(pyridin-4-ylmethylideneamino)pyrimidin-4-amine (PubChem CID 2842106) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 5,6-dimethyl-2-phenyl-N-(pyridin-4-ylmethylideneamino)pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-2-phenyl-N-(pyridin-4-ylmethylideneamino)pyrimidin-4-amine |
|---|---|
| PubChem CID | 2842106 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5,6-dimethyl-2-phenyl-N-(pyridin-4-ylmethylideneamino)pyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccccc2)nc(NN=Cc2ccncc2)c1C |
| InChI | InChI=1S/C18H17N5/c1-13-14(2)21-18(16-6-4-3-5-7-16)22-17(13)23-20-12-15-8-10-19-11-9-15/h3-12H,1-2H3,(H,21,22,23) |
| InChIKey | KMCSGZUIGQRXFW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|