C16H21BrClN3O — CID 2843077
2-(2-bromo-4-chloroanilino)-N-(cyclooctylideneamino)acetamide (PubChem CID 2843077) has the molecular formula C16H21BrClN3O and a molecular weight of 386.72 g/mol. Its IUPAC name is 2-(2-bromo-4-chloroanilino)-N-(cyclooctylideneamino)acetamide.
| Compound Name | 2-(2-bromo-4-chloroanilino)-N-(cyclooctylideneamino)acetamide |
|---|---|
| PubChem CID | 2843077 |
| Molecular Formula | C16H21BrClN3O |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-(2-bromo-4-chloroanilino)-N-(cyclooctylideneamino)acetamide |
| SMILES | O=C(CNc1ccc(Cl)cc1Br)NN=C1CCCCCCC1 |
| InChI | InChI=1S/C16H21BrClN3O/c17-14-10-12(18)8-9-15(14)19-11-16(22)21-20-13-6-4-2-1-3-5-7-13/h8-10,19H,1-7,11H2,(H,21,22) |
| InChIKey | SQFMBCYGNJTTIR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|