C16H14Br2ClN3O — CID 4037059
2-(2-bromo-4-chloroanilino)-N-[1-(4-bromophenyl)ethylideneamino]acetamide (PubChem CID 4037059) has the molecular formula C16H14Br2ClN3O and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-(2-bromo-4-chloroanilino)-N-[1-(4-bromophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-chloroanilino)-N-[1-(4-bromophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 4037059 |
| Molecular Formula | C16H14Br2ClN3O |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 456.92 |
| IUPAC Name | 2-(2-bromo-4-chloroanilino)-N-[1-(4-bromophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CNc1ccc(Cl)cc1Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14Br2ClN3O/c1-10(11-2-4-12(17)5-3-11)21-22-16(23)9-20-15-7-6-13(19)8-14(15)18/h2-8,20H,9H2,1H3,(H,22,23) |
| InChIKey | XUEKEPORXBGLIH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|