C21H25BrClN3O — CID 92652579
2-(2-bromo-4-chloroanilino)-N-[(E)-1-phenylheptylideneamino]acetamide (PubChem CID 92652579) has the molecular formula C21H25BrClN3O and a molecular weight of 450.81 g/mol. Its IUPAC name is 2-(2-bromo-4-chloroanilino)-N-[(E)-1-phenylheptylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-chloroanilino)-N-[(E)-1-phenylheptylideneamino]acetamide |
|---|---|
| PubChem CID | 92652579 |
| Molecular Formula | C21H25BrClN3O |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 2-(2-bromo-4-chloroanilino)-N-[(E)-1-phenylheptylideneamino]acetamide |
| SMILES | CCCCCC/C(=N\NC(=O)CNc1ccc(Cl)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C21H25BrClN3O/c1-2-3-4-8-11-19(16-9-6-5-7-10-16)25-26-21(27)15-24-20-13-12-17(23)14-18(20)22/h5-7,9-10,12-14,24H,2-4,8,11,15H2,1H3,(H,26,27)/b25-19+ |
| InChIKey | MOSRBQWVPYZURP-NCELDCMTSA-N |
| XLogP | 6.01 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|