C15H16N2O2S — CID 2843226
N-(1-benzothiophene-2-carbonyl)piperidine-1-carboxamide (PubChem CID 2843226) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-(1-benzothiophene-2-carbonyl)piperidine-1-carboxamide.
| Compound Name | N-(1-benzothiophene-2-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 2843226 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(1-benzothiophene-2-carbonyl)piperidine-1-carboxamide |
| SMILES | O=C(NC(=O)N1CCCCC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H16N2O2S/c18-14(16-15(19)17-8-4-1-5-9-17)13-10-11-6-2-3-7-12(11)20-13/h2-3,6-7,10H,1,4-5,8-9H2,(H,16,18,19) |
| InChIKey | BZGRMWYHMVBQEG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |