C25H21Br2NO2 — CID 2844473
5-(3,5-dibromo-2-hydroxyphenyl)-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one (PubChem CID 2844473) has the molecular formula C25H21Br2NO2 and a molecular weight of 527.26 g/mol. Its IUPAC name is 5-(3,5-dibromo-2-hydroxyphenyl)-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one.
| Compound Name | 5-(3,5-dibromo-2-hydroxyphenyl)-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 2844473 |
| Molecular Formula | C25H21Br2NO2 |
| Molecular Weight | 527.26 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | 5-(3,5-dibromo-2-hydroxyphenyl)-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)c1c(ccc3ccccc13)NC2c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C25H21Br2NO2/c1-25(2)11-17-21-15-6-4-3-5-13(15)7-8-19(21)28-23(22(17)20(29)12-25)16-9-14(26)10-18(27)24(16)30/h3-10,23,28,30H,11-12H2,1-2H3 |
| InChIKey | ZIFBUANJTJPCQJ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.26 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|