C20H17Cl2N3O4 — CID 2846155
6,8-dichloro-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]chromen-4-one (PubChem CID 2846155) has the molecular formula C20H17Cl2N3O4 and a molecular weight of 434.28 g/mol. Its IUPAC name is 6,8-dichloro-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]chromen-4-one.
| Compound Name | 6,8-dichloro-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 2846155 |
| Molecular Formula | C20H17Cl2N3O4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 6,8-dichloro-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]chromen-4-one |
| SMILES | O=c1c(CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)coc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C20H17Cl2N3O4/c21-14-9-17-19(26)13(12-29-20(17)18(22)10-14)11-23-5-7-24(8-6-23)15-1-3-16(4-2-15)25(27)28/h1-4,9-10,12H,5-8,11H2 |
| InChIKey | POLMGBGDKBOARW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|