C16H31NO — CID 2846696
4-(4-tert-butylcyclohexyl)-2,6-dimethylmorpholine (PubChem CID 2846696) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 4-(4-tert-butylcyclohexyl)-2,6-dimethylmorpholine.
| Compound Name | 4-(4-tert-butylcyclohexyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2846696 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 4-(4-tert-butylcyclohexyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(C2CCC(C(C)(C)C)CC2)CC(C)O1 |
| InChI | InChI=1S/C16H31NO/c1-12-10-17(11-13(2)18-12)15-8-6-14(7-9-15)16(3,4)5/h12-15H,6-11H2,1-5H3 |
| InChIKey | OWBYPXYTTWMOTK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |