C24H27Cl2NO3 — CID 2848542
cyclopentyl 4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 2848542) has the molecular formula C24H27Cl2NO3 and a molecular weight of 448.39 g/mol. Its IUPAC name is cyclopentyl 4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclopentyl 4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2848542 |
| Molecular Formula | C24H27Cl2NO3 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | cyclopentyl 4-(2,3-dichlorophenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCC2)C(c2cccc(Cl)c2Cl)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C24H27Cl2NO3/c1-13-19(23(29)30-14-7-4-5-8-14)20(15-9-6-10-16(25)22(15)26)21-17(27-13)11-24(2,3)12-18(21)28/h6,9-10,14,20,27H,4-5,7-8,11-12H2,1-3H3 |
| InChIKey | MZGLMJVWCWYORV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |