C32H37NO4 — CID 2855138
cyclohexyl 2,7,7-trimethyl-5-oxo-4-(2-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 2855138) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is cyclohexyl 2,7,7-trimethyl-5-oxo-4-(2-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cyclohexyl 2,7,7-trimethyl-5-oxo-4-(2-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2855138 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | cyclohexyl 2,7,7-trimethyl-5-oxo-4-(2-phenylmethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)C(c2ccccc2OCc2ccccc2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C32H37NO4/c1-21-28(31(35)37-23-14-8-5-9-15-23)29(30-25(33-21)18-32(2,3)19-26(30)34)24-16-10-11-17-27(24)36-20-22-12-6-4-7-13-22/h4,6-7,10-13,16-17,23,29,33H,5,8-9,14-15,18-20H2,1-3H3 |
| InChIKey | FPHCOVJWPCAUKA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |