C29H33NO5 — CID 2916577
cycloheptyl 2,7,7-trimethyl-5-oxo-4-(4-oxochromen-3-yl)-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 2916577) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is cycloheptyl 2,7,7-trimethyl-5-oxo-4-(4-oxochromen-3-yl)-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | cycloheptyl 2,7,7-trimethyl-5-oxo-4-(4-oxochromen-3-yl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2916577 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | cycloheptyl 2,7,7-trimethyl-5-oxo-4-(4-oxochromen-3-yl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCCC2)C(c2coc3ccccc3c2=O)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C29H33NO5/c1-17-24(28(33)35-18-10-6-4-5-7-11-18)25(26-21(30-17)14-29(2,3)15-22(26)31)20-16-34-23-13-9-8-12-19(23)27(20)32/h8-9,12-13,16,18,25,30H,4-7,10-11,14-15H2,1-3H3 |
| InChIKey | YZZKBLYWFLVETE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |