C13H18N2O6 — CID 2848761
2-methyl-6-(2-methyl-4-nitroanilino)oxane-3,4,5-triol (PubChem CID 2848761) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-methyl-6-(2-methyl-4-nitroanilino)oxane-3,4,5-triol.
| Compound Name | 2-methyl-6-(2-methyl-4-nitroanilino)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 2848761 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-methyl-6-(2-methyl-4-nitroanilino)oxane-3,4,5-triol |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C13H18N2O6/c1-6-5-8(15(19)20)3-4-9(6)14-13-12(18)11(17)10(16)7(2)21-13/h3-5,7,10-14,16-18H,1-2H3 |
| InChIKey | SMOCAIOGNVIDED-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|