C14H17N3O4 — CID 28507243
N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-piperazin-1-ylacetamide (PubChem CID 28507243) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-piperazin-1-ylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 28507243 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-oxo-2-piperazin-1-ylacetamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C14H17N3O4/c18-13(14(19)17-5-3-15-4-6-17)16-8-10-1-2-11-12(7-10)21-9-20-11/h1-2,7,15H,3-6,8-9H2,(H,16,18) |
| InChIKey | IFUYANLOTSCKBD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|