C11H14N4O5 — CID 2851365
2-(dimethylamino)-N,N-dimethyl-3,5-dinitrobenzamide (PubChem CID 2851365) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-(dimethylamino)-N,N-dimethyl-3,5-dinitrobenzamide.
| Compound Name | 2-(dimethylamino)-N,N-dimethyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 2851365 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(dimethylamino)-N,N-dimethyl-3,5-dinitrobenzamide |
| SMILES | CN(C)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N(C)C |
| InChI | InChI=1S/C11H14N4O5/c1-12(2)10-8(11(16)13(3)4)5-7(14(17)18)6-9(10)15(19)20/h5-6H,1-4H3 |
| InChIKey | OJQCOSUJNGFNDL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|