C9H8N4O7 — CID 541760
N,N-dimethyl-2,4,6-trinitrobenzamide (PubChem CID 541760) has the molecular formula C9H8N4O7 and a molecular weight of 284.18 g/mol. Its IUPAC name is N,N-dimethyl-2,4,6-trinitrobenzamide.
| Compound Name | N,N-dimethyl-2,4,6-trinitrobenzamide |
|---|---|
| PubChem CID | 541760 |
| Molecular Formula | C9H8N4O7 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N,N-dimethyl-2,4,6-trinitrobenzamide |
| SMILES | CN(C)C(=O)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N4O7/c1-10(2)9(14)8-6(12(17)18)3-5(11(15)16)4-7(8)13(19)20/h3-4H,1-2H3 |
| InChIKey | LWHZPNRTHDMZNR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 149.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|